C27H32N8O4 — CID 137289866
2-[4-[[4-ethoxy-3-(3-ethyl-1-methyl-7-oxo-6H-pyrazolo[4,5-d]pyrimidin-5-yl)phenyl]methyl]piperidin-1-yl]-N-hydroxypyrimidine-5-carboxamide (PubChem CID 137289866) has the molecular formula C27H32N8O4 and a molecular weight of 532.61 g/mol. Its IUPAC name is 2-[4-[[4-ethoxy-3-(3-ethyl-1-methyl-7-oxo-6H-pyrazolo[4,5-d]pyrimidin-5-yl)phenyl]methyl]piperidin-1-yl]-N-hydroxypyrimidine-5-carboxamide.
| Compound Name | 2-[4-[[4-ethoxy-3-(3-ethyl-1-methyl-7-oxo-6H-pyrazolo[4,5-d]pyrimidin-5-yl)phenyl]methyl]piperidin-1-yl]-N-hydroxypyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 137289866 |
| Molecular Formula | C27H32N8O4 |
| Molecular Weight | 532.61 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | 2-[4-[[4-ethoxy-3-(3-ethyl-1-methyl-7-oxo-6H-pyrazolo[4,5-d]pyrimidin-5-yl)phenyl]methyl]piperidin-1-yl]-N-hydroxypyrimidine-5-carboxamide |
| SMILES | CCOc1ccc(CC2CCN(c3ncc(C(=O)NO)cn3)CC2)cc1-c1nc2c(CC)nn(C)c2c(=O)[nH]1 |
| InChI | InChI=1S/C27H32N8O4/c1-4-20-22-23(34(3)32-20)26(37)31-24(30-22)19-13-17(6-7-21(19)39-5-2)12-16-8-10-35(11-9-16)27-28-14-18(15-29-27)25(36)33-38/h6-7,13-16,38H,4-5,8-12H2,1-3H3,(H,33,36)(H,30,31,37) |
| InChIKey | VLMYLGPYYNFPET-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 151.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.61 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|