C15H12N4OS — CID 136646624
1-(4-oxo-3H-quinazolin-2-yl)-3-phenylthiourea (PubChem CID 136646624) has the molecular formula C15H12N4OS and a molecular weight of 296.36 g/mol. Its IUPAC name is 1-(4-oxo-3H-quinazolin-2-yl)-3-phenylthiourea.
| Compound Name | 1-(4-oxo-3H-quinazolin-2-yl)-3-phenylthiourea |
|---|---|
| PubChem CID | 136646624 |
| Molecular Formula | C15H12N4OS |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 1-(4-oxo-3H-quinazolin-2-yl)-3-phenylthiourea |
| SMILES | O=c1[nH]c(NC(=S)Nc2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C15H12N4OS/c20-13-11-8-4-5-9-12(11)17-14(18-13)19-15(21)16-10-6-2-1-3-7-10/h1-9H,(H3,16,17,18,19,20,21) |
| InChIKey | GDSIJTVVVUNSDD-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|