About 4-[2-[4-(2,4-dichlorophenyl)-1-[(4-nitrophenyl)methyl]imidazol-2-yl]ethenyl]phenol
4-[2-[4-(2,4-dichlorophenyl)-1-[(4-nitrophenyl)methyl]imidazol-2-yl]ethenyl]phenol (PubChem CID 136647811) has the molecular formula C24H17Cl2N3O3
and a molecular weight of 466.32 g/mol. Its IUPAC name is 4-[2-[4-(2,4-dichlorophenyl)-1-[(4-nitrophenyl)methyl]imidazol-2-yl]ethenyl]phenol.
Molecular Properties
| Compound Name | 4-[2-[4-(2,4-dichlorophenyl)-1-[(4-nitrophenyl)methyl]imidazol-2-yl]ethenyl]phenol |
| PubChem CID | 136647811 |
| Molecular Formula | C24H17Cl2N3O3 |
| Molecular Weight | 466.32 g/mol |
| Exact Mass | 465.06 |
| IUPAC Name | 4-[2-[4-(2,4-dichlorophenyl)-1-[(4-nitrophenyl)methyl]imidazol-2-yl]ethenyl]phenol |
| SMILES | O=[N+]([O-])c1ccc(Cn2cc(-c3ccc(Cl)cc3Cl)nc2C=Cc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C24H17Cl2N3O3/c25-18-6-11-21(22(26)13-18)23-15-28(14-17-1-7-19(8-2-17)29(31)32)24(27-23)12-5-16-3-9-20(30)10-4-16/h1-13,15,30H,14H2 |
| InChIKey | JEZPMHJJVISGEM-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.32 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-[4-(2,4-dichlorophenyl)-1-[(4-nitrophenyl)methyl]imidazol-2-yl]ethenyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[4-(2,4-dichlorophenyl)-1-[(4-nitrophenyl)methyl]imidazol-2-yl]ethenyl]phenol?
The IUPAC name of 4-[2-[4-(2,4-dichlorophenyl)-1-[(4-nitrophenyl)methyl]imidazol-2-yl]ethenyl]phenol (CID 136647811) is 4-[2-[4-(2,4-dichlorophenyl)-1-[(4-nitrophenyl)methyl]imidazol-2-yl]ethenyl]phenol.
What is the SMILES notation for 4-[2-[4-(2,4-dichlorophenyl)-1-[(4-nitrophenyl)methyl]imidazol-2-yl]ethenyl]phenol?
The canonical SMILES for 4-[2-[4-(2,4-dichlorophenyl)-1-[(4-nitrophenyl)methyl]imidazol-2-yl]ethenyl]phenol is O=[N+]([O-])c1ccc(Cn2cc(-c3ccc(Cl)cc3Cl)nc2C=Cc2ccc(O)cc2)cc1.
What is the InChIKey of 4-[2-[4-(2,4-dichlorophenyl)-1-[(4-nitrophenyl)methyl]imidazol-2-yl]ethenyl]phenol?
The InChIKey is JEZPMHJJVISGEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H17Cl2N3O3/c25-18-6-11-21(22(26)13-18)23-15-28(14-17-1-7-19(8-2-17)29(31)32)24(27-23)12-5-16-3-9-20(30)10-4-16/h1-13,15,30H,14H2.
What are the key properties of 4-[2-[4-(2,4-dichlorophenyl)-1-[(4-nitrophenyl)methyl]imidazol-2-yl]ethenyl]phenol?
4-[2-[4-(2,4-dichlorophenyl)-1-[(4-nitrophenyl)methyl]imidazol-2-yl]ethenyl]phenol has a molecular weight of 466.32 g/mol, XLogP of 6.69, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[4-(2,4-dichlorophenyl)-1-[(4-nitrophenyl)methyl]imidazol-2-yl]ethenyl]phenol is sourced from PubChem (CID 136647811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).