C25H15ClFN3O3S — CID 136648158
5-[(4-chloro-7-fluoroindol-3-ylidene)methyl]-6-hydroxy-1-(4-phenoxyphenyl)-2-sulfanylidenepyrimidin-4-one (PubChem CID 136648158) has the molecular formula C25H15ClFN3O3S and a molecular weight of 491.93 g/mol. Its IUPAC name is 5-[(4-chloro-7-fluoroindol-3-ylidene)methyl]-6-hydroxy-1-(4-phenoxyphenyl)-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 5-[(4-chloro-7-fluoroindol-3-ylidene)methyl]-6-hydroxy-1-(4-phenoxyphenyl)-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 136648158 |
| Molecular Formula | C25H15ClFN3O3S |
| Molecular Weight | 491.93 g/mol |
| Exact Mass | 491.05 |
| IUPAC Name | 5-[(4-chloro-7-fluoroindol-3-ylidene)methyl]-6-hydroxy-1-(4-phenoxyphenyl)-2-sulfanylidenepyrimidin-4-one |
| SMILES | O=c1[nH]c(=S)n(-c2ccc(Oc3ccccc3)cc2)c(O)c1C=C1C=Nc2c(F)ccc(Cl)c21 |
| InChI | InChI=1S/C25H15ClFN3O3S/c26-19-10-11-20(27)22-21(19)14(13-28-22)12-18-23(31)29-25(34)30(24(18)32)15-6-8-17(9-7-15)33-16-4-2-1-3-5-16/h1-13,32H,(H,29,31,34) |
| InChIKey | ASHQDKIJJQXWIE-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.93 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|