C19H13ClFN3O5S — CID 3543238
2-[4-[[1-(3-chloro-4-fluorophenyl)-6-hydroxy-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]phenoxy]acetic acid (PubChem CID 3543238) has the molecular formula C19H13ClFN3O5S and a molecular weight of 449.85 g/mol. Its IUPAC name is 2-[4-[[1-(3-chloro-4-fluorophenyl)-6-hydroxy-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]phenoxy]acetic acid.
| Compound Name | 2-[4-[[1-(3-chloro-4-fluorophenyl)-6-hydroxy-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]phenoxy]acetic acid |
|---|---|
| PubChem CID | 3543238 |
| Molecular Formula | C19H13ClFN3O5S |
| Molecular Weight | 449.85 g/mol |
| Exact Mass | 449.02 |
| IUPAC Name | 2-[4-[[1-(3-chloro-4-fluorophenyl)-6-hydroxy-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(/N=C/c2c(O)n(-c3ccc(F)c(Cl)c3)c(=S)[nH]c2=O)cc1 |
| InChI | InChI=1S/C19H13ClFN3O5S/c20-14-7-11(3-6-15(14)21)24-18(28)13(17(27)23-19(24)30)8-22-10-1-4-12(5-2-10)29-9-16(25)26/h1-8,28H,9H2,(H,25,26)(H,23,27,30)/b22-8+ |
| InChIKey | ZOUVDWQAALLLMU-GZIVZEMBSA-N |
| XLogP | 3.61 |
| TPSA | 116.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.85 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|