C18H11ClFN3O4S — CID 3995109
5-(1,3-benzodioxol-5-yliminomethyl)-1-(3-chloro-4-fluorophenyl)-6-hydroxy-2-sulfanylidenepyrimidin-4-one (PubChem CID 3995109) has the molecular formula C18H11ClFN3O4S and a molecular weight of 419.82 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yliminomethyl)-1-(3-chloro-4-fluorophenyl)-6-hydroxy-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 5-(1,3-benzodioxol-5-yliminomethyl)-1-(3-chloro-4-fluorophenyl)-6-hydroxy-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 3995109 |
| Molecular Formula | C18H11ClFN3O4S |
| Molecular Weight | 419.82 g/mol |
| Exact Mass | 419.01 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yliminomethyl)-1-(3-chloro-4-fluorophenyl)-6-hydroxy-2-sulfanylidenepyrimidin-4-one |
| SMILES | O=c1[nH]c(=S)n(-c2ccc(F)c(Cl)c2)c(O)c1/C=N/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H11ClFN3O4S/c19-12-6-10(2-3-13(12)20)23-17(25)11(16(24)22-18(23)28)7-21-9-1-4-14-15(5-9)27-8-26-14/h1-7,25H,8H2,(H,22,24,28)/b21-7+ |
| InChIKey | FMBPIAJPJSRUIM-QPSGOUHRSA-N |
| XLogP | 3.87 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.82 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|