C23H14Cl2FN3O3S — CID 137144762
1-(3-chloro-4-fluorophenyl)-5-[[4-(2-chlorophenoxy)phenyl]iminomethyl]-6-hydroxy-2-sulfanylidenepyrimidin-4-one (PubChem CID 137144762) has the molecular formula C23H14Cl2FN3O3S and a molecular weight of 502.35 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-5-[[4-(2-chlorophenoxy)phenyl]iminomethyl]-6-hydroxy-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-5-[[4-(2-chlorophenoxy)phenyl]iminomethyl]-6-hydroxy-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 137144762 |
| Molecular Formula | C23H14Cl2FN3O3S |
| Molecular Weight | 502.35 g/mol |
| Exact Mass | 501.01 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-5-[[4-(2-chlorophenoxy)phenyl]iminomethyl]-6-hydroxy-2-sulfanylidenepyrimidin-4-one |
| SMILES | O=c1[nH]c(=S)n(-c2ccc(F)c(Cl)c2)c(O)c1/C=N/c1ccc(Oc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C23H14Cl2FN3O3S/c24-17-3-1-2-4-20(17)32-15-8-5-13(6-9-15)27-12-16-21(30)28-23(33)29(22(16)31)14-7-10-19(26)18(25)11-14/h1-12,31H,(H,28,30,33)/b27-12+ |
| InChIKey | QQBASNRPVZZHSA-KKMKTNMSSA-N |
| XLogP | 6.59 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.35 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|