C18H13ClFN3O3S — CID 135840075
5-[(3-chloro-4-methoxyphenyl)iminomethyl]-1-(4-fluorophenyl)-6-hydroxy-2-sulfanylidenepyrimidin-4-one (PubChem CID 135840075) has the molecular formula C18H13ClFN3O3S and a molecular weight of 405.84 g/mol. Its IUPAC name is 5-[(3-chloro-4-methoxyphenyl)iminomethyl]-1-(4-fluorophenyl)-6-hydroxy-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 5-[(3-chloro-4-methoxyphenyl)iminomethyl]-1-(4-fluorophenyl)-6-hydroxy-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 135840075 |
| Molecular Formula | C18H13ClFN3O3S |
| Molecular Weight | 405.84 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | 5-[(3-chloro-4-methoxyphenyl)iminomethyl]-1-(4-fluorophenyl)-6-hydroxy-2-sulfanylidenepyrimidin-4-one |
| SMILES | COc1ccc(/N=C/c2c(O)n(-c3ccc(F)cc3)c(=S)[nH]c2=O)cc1Cl |
| InChI | InChI=1S/C18H13ClFN3O3S/c1-26-15-7-4-11(8-14(15)19)21-9-13-16(24)22-18(27)23(17(13)25)12-5-2-10(20)3-6-12/h2-9,25H,1H3,(H,22,24,27)/b21-9+ |
| InChIKey | KPURMKGQXJVTCS-ZVBGSRNCSA-N |
| XLogP | 4.15 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.84 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|