C17H10BrClFN3O2S — CID 137144766
5-[(4-bromophenyl)iminomethyl]-1-(3-chloro-4-fluorophenyl)-6-hydroxy-2-sulfanylidenepyrimidin-4-one (PubChem CID 137144766) has the molecular formula C17H10BrClFN3O2S and a molecular weight of 454.71 g/mol. Its IUPAC name is 5-[(4-bromophenyl)iminomethyl]-1-(3-chloro-4-fluorophenyl)-6-hydroxy-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 5-[(4-bromophenyl)iminomethyl]-1-(3-chloro-4-fluorophenyl)-6-hydroxy-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 137144766 |
| Molecular Formula | C17H10BrClFN3O2S |
| Molecular Weight | 454.71 g/mol |
| Exact Mass | 452.93 |
| IUPAC Name | 5-[(4-bromophenyl)iminomethyl]-1-(3-chloro-4-fluorophenyl)-6-hydroxy-2-sulfanylidenepyrimidin-4-one |
| SMILES | O=c1[nH]c(=S)n(-c2ccc(F)c(Cl)c2)c(O)c1/C=N/c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H10BrClFN3O2S/c18-9-1-3-10(4-2-9)21-8-12-15(24)22-17(26)23(16(12)25)11-5-6-14(20)13(19)7-11/h1-8,25H,(H,22,24,26)/b21-8+ |
| InChIKey | SCDTZHVDKREAED-ODCIPOBUSA-N |
| XLogP | 4.91 |
| TPSA | 70.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.71 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|