C19H14FN3O3S — CID 135784170
5-[(3-acetylphenyl)iminomethyl]-1-(4-fluorophenyl)-6-hydroxy-2-sulfanylidenepyrimidin-4-one (PubChem CID 135784170) has the molecular formula C19H14FN3O3S and a molecular weight of 383.40 g/mol. Its IUPAC name is 5-[(3-acetylphenyl)iminomethyl]-1-(4-fluorophenyl)-6-hydroxy-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 5-[(3-acetylphenyl)iminomethyl]-1-(4-fluorophenyl)-6-hydroxy-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 135784170 |
| Molecular Formula | C19H14FN3O3S |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | 5-[(3-acetylphenyl)iminomethyl]-1-(4-fluorophenyl)-6-hydroxy-2-sulfanylidenepyrimidin-4-one |
| SMILES | CC(=O)c1cccc(/N=C/c2c(O)n(-c3ccc(F)cc3)c(=S)[nH]c2=O)c1 |
| InChI | InChI=1S/C19H14FN3O3S/c1-11(24)12-3-2-4-14(9-12)21-10-16-17(25)22-19(27)23(18(16)26)15-7-5-13(20)6-8-15/h2-10,26H,1H3,(H,22,25,27)/b21-10+ |
| InChIKey | LDELFPULDASWRF-UFFVCSGVSA-N |
| XLogP | 3.69 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|