C19H14FN3O4S — CID 135784193
3-[[1-(4-fluorophenyl)-6-hydroxy-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]-2-methylbenzoic acid (PubChem CID 135784193) has the molecular formula C19H14FN3O4S and a molecular weight of 399.40 g/mol. Its IUPAC name is 3-[[1-(4-fluorophenyl)-6-hydroxy-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]-2-methylbenzoic acid.
| Compound Name | 3-[[1-(4-fluorophenyl)-6-hydroxy-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 135784193 |
| Molecular Formula | C19H14FN3O4S |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 3-[[1-(4-fluorophenyl)-6-hydroxy-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]-2-methylbenzoic acid |
| SMILES | Cc1c(/N=C/c2c(O)n(-c3ccc(F)cc3)c(=S)[nH]c2=O)cccc1C(=O)O |
| InChI | InChI=1S/C19H14FN3O4S/c1-10-13(18(26)27)3-2-4-15(10)21-9-14-16(24)22-19(28)23(17(14)25)12-7-5-11(20)6-8-12/h2-9,25H,1H3,(H,26,27)(H,22,24,28)/b21-9+ |
| InChIKey | WMINAMSESPPKDG-ZVBGSRNCSA-N |
| XLogP | 3.50 |
| TPSA | 107.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|