C23H23FN4O2S — CID 2844567
5-[(1-benzylpiperidin-4-yl)iminomethyl]-1-(4-fluorophenyl)-6-hydroxy-2-sulfanylidenepyrimidin-4-one (PubChem CID 2844567) has the molecular formula C23H23FN4O2S and a molecular weight of 438.53 g/mol. Its IUPAC name is 5-[(1-benzylpiperidin-4-yl)iminomethyl]-1-(4-fluorophenyl)-6-hydroxy-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 5-[(1-benzylpiperidin-4-yl)iminomethyl]-1-(4-fluorophenyl)-6-hydroxy-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 2844567 |
| Molecular Formula | C23H23FN4O2S |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 5-[(1-benzylpiperidin-4-yl)iminomethyl]-1-(4-fluorophenyl)-6-hydroxy-2-sulfanylidenepyrimidin-4-one |
| SMILES | O=c1[nH]c(=S)n(-c2ccc(F)cc2)c(O)c1/C=N/C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H23FN4O2S/c24-17-6-8-19(9-7-17)28-22(30)20(21(29)26-23(28)31)14-25-18-10-12-27(13-11-18)15-16-4-2-1-3-5-16/h1-9,14,18,30H,10-13,15H2,(H,26,29,31)/b25-14+ |
| InChIKey | VXPRDQNRCSEROJ-AFUMVMLFSA-N |
| XLogP | 3.82 |
| TPSA | 73.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|