C28H26ClN7O3S2 — CID 136649695
4-[5-[2-[[(1R)-3-(4-chlorophenyl)sulfonylcyclohexyl]amino]pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]-N'-hydroxybenzenecarboximidamide (PubChem CID 136649695) has the molecular formula C28H26ClN7O3S2 and a molecular weight of 608.15 g/mol. Its IUPAC name is 4-[5-[2-[[(1R)-3-(4-chlorophenyl)sulfonylcyclohexyl]amino]pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-[5-[2-[[(1R)-3-(4-chlorophenyl)sulfonylcyclohexyl]amino]pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 136649695 |
| Molecular Formula | C28H26ClN7O3S2 |
| Molecular Weight | 608.15 g/mol |
| Exact Mass | 607.12 |
| IUPAC Name | 4-[5-[2-[[(1R)-3-(4-chlorophenyl)sulfonylcyclohexyl]amino]pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]-N'-hydroxybenzenecarboximidamide |
| SMILES | NC(=NO)c1ccc(-c2nc3sccn3c2-c2ccnc(N[C@@H]3CCCC(S(=O)(=O)c4ccc(Cl)cc4)C3)n2)cc1 |
| InChI | InChI=1S/C28H26ClN7O3S2/c29-19-8-10-21(11-9-19)41(38,39)22-3-1-2-20(16-22)32-27-31-13-12-23(33-27)25-24(34-28-36(25)14-15-40-28)17-4-6-18(7-5-17)26(30)35-37/h4-15,20,22,37H,1-3,16H2,(H2,30,35)(H,31,32,33)/t20-,22?/m1/s1 |
| InChIKey | NSPWNDOAMMNWMY-PSDZMVHGSA-N |
| XLogP | 5.46 |
| TPSA | 147.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.15 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|