C26H24ClN7O2S2 — CID 57463152
4-[6-(3-aminophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-N-[(3R)-1-(4-chlorophenyl)sulfonylpiperidin-3-yl]pyrimidin-2-amine (PubChem CID 57463152) has the molecular formula C26H24ClN7O2S2 and a molecular weight of 566.11 g/mol. Its IUPAC name is 4-[6-(3-aminophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-N-[(3R)-1-(4-chlorophenyl)sulfonylpiperidin-3-yl]pyrimidin-2-amine.
| Compound Name | 4-[6-(3-aminophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-N-[(3R)-1-(4-chlorophenyl)sulfonylpiperidin-3-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 57463152 |
| Molecular Formula | C26H24ClN7O2S2 |
| Molecular Weight | 566.11 g/mol |
| Exact Mass | 565.11 |
| IUPAC Name | 4-[6-(3-aminophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-N-[(3R)-1-(4-chlorophenyl)sulfonylpiperidin-3-yl]pyrimidin-2-amine |
| SMILES | Nc1cccc(-c2nc3sccn3c2-c2ccnc(N[C@@H]3CCCN(S(=O)(=O)c4ccc(Cl)cc4)C3)n2)c1 |
| InChI | InChI=1S/C26H24ClN7O2S2/c27-18-6-8-21(9-7-18)38(35,36)33-12-2-5-20(16-33)30-25-29-11-10-22(31-25)24-23(17-3-1-4-19(28)15-17)32-26-34(24)13-14-37-26/h1,3-4,6-11,13-15,20H,2,5,12,16,28H2,(H,29,30,31)/t20-/m1/s1 |
| InChIKey | USWGSMCVRYAAKC-HXUWFJFHSA-N |
| XLogP | 5.02 |
| TPSA | 118.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.11 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|