C18H19NOS — CID 136650090
2-(1,3-benzothiazol-2-yl)-6-tert-butyl-4-methylphenol (PubChem CID 136650090) has the molecular formula C18H19NOS and a molecular weight of 297.42 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-6-tert-butyl-4-methylphenol.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-6-tert-butyl-4-methylphenol |
|---|---|
| PubChem CID | 136650090 |
| Molecular Formula | C18H19NOS |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-6-tert-butyl-4-methylphenol |
| SMILES | Cc1cc(-c2nc3ccccc3s2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H19NOS/c1-11-9-12(16(20)13(10-11)18(2,3)4)17-19-14-7-5-6-8-15(14)21-17/h5-10,20H,1-4H3 |
| InChIKey | CCWJWVUDIQSHCD-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |