C22H24N6O — CID 136650276
N'-hydroxy-5-[2-(2-phenylethenyl)-4-pyridinyl]-2-piperazin-1-yl-1H-pyrrole-3-carboximidamide (PubChem CID 136650276) has the molecular formula C22H24N6O and a molecular weight of 388.48 g/mol. Its IUPAC name is N'-hydroxy-5-[2-(2-phenylethenyl)-4-pyridinyl]-2-piperazin-1-yl-1H-pyrrole-3-carboximidamide.
| Compound Name | N'-hydroxy-5-[2-(2-phenylethenyl)-4-pyridinyl]-2-piperazin-1-yl-1H-pyrrole-3-carboximidamide |
|---|---|
| PubChem CID | 136650276 |
| Molecular Formula | C22H24N6O |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | N'-hydroxy-5-[2-(2-phenylethenyl)-4-pyridinyl]-2-piperazin-1-yl-1H-pyrrole-3-carboximidamide |
| SMILES | NC(=NO)c1cc(-c2ccnc(C=Cc3ccccc3)c2)[nH]c1N1CCNCC1 |
| InChI | InChI=1S/C22H24N6O/c23-21(27-29)19-15-20(26-22(19)28-12-10-24-11-13-28)17-8-9-25-18(14-17)7-6-16-4-2-1-3-5-16/h1-9,14-15,24,26,29H,10-13H2,(H2,23,27) |
| InChIKey | GCDITJJZRUIGMJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 102.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|