C24H25N7O — CID 24959355
5-[2-(1-benzylpyrazol-4-yl)-4-pyridinyl]-2-piperazin-1-yl-1H-pyrrole-3-carboxamide (PubChem CID 24959355) has the molecular formula C24H25N7O and a molecular weight of 427.51 g/mol. Its IUPAC name is 5-[2-(1-benzylpyrazol-4-yl)-4-pyridinyl]-2-piperazin-1-yl-1H-pyrrole-3-carboxamide.
| Compound Name | 5-[2-(1-benzylpyrazol-4-yl)-4-pyridinyl]-2-piperazin-1-yl-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 24959355 |
| Molecular Formula | C24H25N7O |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 5-[2-(1-benzylpyrazol-4-yl)-4-pyridinyl]-2-piperazin-1-yl-1H-pyrrole-3-carboxamide |
| SMILES | NC(=O)c1cc(-c2ccnc(-c3cnn(Cc4ccccc4)c3)c2)[nH]c1N1CCNCC1 |
| InChI | InChI=1S/C24H25N7O/c25-23(32)20-13-22(29-24(20)30-10-8-26-9-11-30)18-6-7-27-21(12-18)19-14-28-31(16-19)15-17-4-2-1-3-5-17/h1-7,12-14,16,26,29H,8-11,15H2,(H2,25,32) |
| InChIKey | QZUXBDDAGMGSHK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |