C36H35N5O5 — CID 136650704
4-[2-[4-hydroxy-3-[(2-methylphenyl)diazenyl]phenyl]ethylamino]-4-oxobut-2-enoic acid;1-(4-phenyldiazenylphenyl)pent-4-en-2-one (PubChem CID 136650704) has the molecular formula C36H35N5O5 and a molecular weight of 617.71 g/mol. Its IUPAC name is 4-[2-[4-hydroxy-3-[(2-methylphenyl)diazenyl]phenyl]ethylamino]-4-oxobut-2-enoic acid;1-(4-phenyldiazenylphenyl)pent-4-en-2-one.
| Compound Name | 4-[2-[4-hydroxy-3-[(2-methylphenyl)diazenyl]phenyl]ethylamino]-4-oxobut-2-enoic acid;1-(4-phenyldiazenylphenyl)pent-4-en-2-one |
|---|---|
| PubChem CID | 136650704 |
| Molecular Formula | C36H35N5O5 |
| Molecular Weight | 617.71 g/mol |
| Exact Mass | 617.26 |
| IUPAC Name | 4-[2-[4-hydroxy-3-[(2-methylphenyl)diazenyl]phenyl]ethylamino]-4-oxobut-2-enoic acid;1-(4-phenyldiazenylphenyl)pent-4-en-2-one |
| SMILES | C=CCC(=O)Cc1ccc(/N=N/c2ccccc2)cc1.Cc1ccccc1/N=N/c1cc(CCNC(=O)C=CC(=O)O)ccc1O |
| InChI | InChI=1S/C19H19N3O4.C17H16N2O/c1-13-4-2-3-5-15(13)21-22-16-12-14(6-7-17(16)23)10-11-20-18(24)8-9-19(25)26;1-2-6-17(20)13-14-9-11-16(12-10-14)19-18-15-7-4-3-5-8-15/h2-9,12,23H,10-11H2,1H3,(H,20,24)(H,25,26);2-5,7-12H,1,6,13H2/b9-8?,22-21+;19-18+ |
| InChIKey | XHSUWOLNVUWNNK-XBHPMLSHSA-N |
| XLogP | 8.21 |
| TPSA | 153.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.71 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|