C19H19N3O4 — CID 136618059
4-[2-[4-hydroxy-3-[(2-methylphenyl)diazenyl]phenyl]ethylamino]-4-oxobut-2-enoic acid (PubChem CID 136618059) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is 4-[2-[4-hydroxy-3-[(2-methylphenyl)diazenyl]phenyl]ethylamino]-4-oxobut-2-enoic acid.
| Compound Name | 4-[2-[4-hydroxy-3-[(2-methylphenyl)diazenyl]phenyl]ethylamino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 136618059 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 4-[2-[4-hydroxy-3-[(2-methylphenyl)diazenyl]phenyl]ethylamino]-4-oxobut-2-enoic acid |
| SMILES | Cc1ccccc1/N=N/c1cc(CCNC(=O)C=CC(=O)O)ccc1O |
| InChI | InChI=1S/C19H19N3O4/c1-13-4-2-3-5-15(13)21-22-16-12-14(6-7-17(16)23)10-11-20-18(24)8-9-19(25)26/h2-9,12,23H,10-11H2,1H3,(H,20,24)(H,25,26)/b9-8?,22-21+ |
| InChIKey | JZEFVLPPRLBVPX-MPXLNWDVSA-N |
| XLogP | 3.42 |
| TPSA | 111.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|