C20H23NO2 — CID 84557472
(E)-3-(4-methoxy-2,6-dimethylphenyl)-N-(2-phenylethyl)prop-2-enamide (PubChem CID 84557472) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is (E)-3-(4-methoxy-2,6-dimethylphenyl)-N-(2-phenylethyl)prop-2-enamide.
| Compound Name | (E)-3-(4-methoxy-2,6-dimethylphenyl)-N-(2-phenylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 84557472 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | (E)-3-(4-methoxy-2,6-dimethylphenyl)-N-(2-phenylethyl)prop-2-enamide |
| SMILES | COc1cc(C)c(/C=C/C(=O)NCCc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C20H23NO2/c1-15-13-18(23-3)14-16(2)19(15)9-10-20(22)21-12-11-17-7-5-4-6-8-17/h4-10,13-14H,11-12H2,1-3H3,(H,21,22)/b10-9+ |
| InChIKey | ZMKAEAWXKWSHRU-MDZDMXLPSA-N |
| XLogP | 3.68 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|