C18H27NO3 — CID 84557501
(E)-3-(4-methoxy-2,6-dimethylphenyl)-N-(3-propan-2-yloxypropyl)prop-2-enamide (PubChem CID 84557501) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is (E)-3-(4-methoxy-2,6-dimethylphenyl)-N-(3-propan-2-yloxypropyl)prop-2-enamide.
| Compound Name | (E)-3-(4-methoxy-2,6-dimethylphenyl)-N-(3-propan-2-yloxypropyl)prop-2-enamide |
|---|---|
| PubChem CID | 84557501 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | (E)-3-(4-methoxy-2,6-dimethylphenyl)-N-(3-propan-2-yloxypropyl)prop-2-enamide |
| SMILES | COc1cc(C)c(/C=C/C(=O)NCCCOC(C)C)c(C)c1 |
| InChI | InChI=1S/C18H27NO3/c1-13(2)22-10-6-9-19-18(20)8-7-17-14(3)11-16(21-5)12-15(17)4/h7-8,11-13H,6,9-10H2,1-5H3,(H,19,20)/b8-7+ |
| InChIKey | KDELVEVDPJYNFK-BQYQJAHWSA-N |
| XLogP | 3.26 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|