C24H26N2O2 — CID 84552085
(E)-3-(4-methoxy-2,6-dimethylphenyl)-N-[2-(naphthalen-1-ylamino)ethyl]prop-2-enamide (PubChem CID 84552085) has the molecular formula C24H26N2O2 and a molecular weight of 374.48 g/mol. Its IUPAC name is (E)-3-(4-methoxy-2,6-dimethylphenyl)-N-[2-(naphthalen-1-ylamino)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(4-methoxy-2,6-dimethylphenyl)-N-[2-(naphthalen-1-ylamino)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 84552085 |
| Molecular Formula | C24H26N2O2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | (E)-3-(4-methoxy-2,6-dimethylphenyl)-N-[2-(naphthalen-1-ylamino)ethyl]prop-2-enamide |
| SMILES | COc1cc(C)c(/C=C/C(=O)NCCNc2cccc3ccccc23)c(C)c1 |
| InChI | InChI=1S/C24H26N2O2/c1-17-15-20(28-3)16-18(2)21(17)11-12-24(27)26-14-13-25-23-10-6-8-19-7-4-5-9-22(19)23/h4-12,15-16,25H,13-14H2,1-3H3,(H,26,27)/b12-11+ |
| InChIKey | OBCCIPRSWBPAMZ-VAWYXSNFSA-N |
| XLogP | 4.71 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|