C29H28Cl2N4O2 — CID 136651311
1-[(4-tert-butylphenyl)methyl]-N-[1-(5-chloro-2-hydroxyphenyl)ethylideneamino]-3-(4-chlorophenyl)pyrazole-5-carboxamide (PubChem CID 136651311) has the molecular formula C29H28Cl2N4O2 and a molecular weight of 535.48 g/mol. Its IUPAC name is 1-[(4-tert-butylphenyl)methyl]-N-[1-(5-chloro-2-hydroxyphenyl)ethylideneamino]-3-(4-chlorophenyl)pyrazole-5-carboxamide.
| Compound Name | 1-[(4-tert-butylphenyl)methyl]-N-[1-(5-chloro-2-hydroxyphenyl)ethylideneamino]-3-(4-chlorophenyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 136651311 |
| Molecular Formula | C29H28Cl2N4O2 |
| Molecular Weight | 535.48 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | 1-[(4-tert-butylphenyl)methyl]-N-[1-(5-chloro-2-hydroxyphenyl)ethylideneamino]-3-(4-chlorophenyl)pyrazole-5-carboxamide |
| SMILES | CC(=NNC(=O)c1cc(-c2ccc(Cl)cc2)nn1Cc1ccc(C(C)(C)C)cc1)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C29H28Cl2N4O2/c1-18(24-15-23(31)13-14-27(24)36)32-33-28(37)26-16-25(20-7-11-22(30)12-8-20)34-35(26)17-19-5-9-21(10-6-19)29(2,3)4/h5-16,36H,17H2,1-4H3,(H,33,37) |
| InChIKey | YHQQJQQDOCXKPR-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.48 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|