C20H22ClN3 — CID 698991
3-(4-tert-butylphenyl)-1-[(4-chlorophenyl)methyl]pyrazol-5-amine (PubChem CID 698991) has the molecular formula C20H22ClN3 and a molecular weight of 339.87 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-1-[(4-chlorophenyl)methyl]pyrazol-5-amine.
| Compound Name | 3-(4-tert-butylphenyl)-1-[(4-chlorophenyl)methyl]pyrazol-5-amine |
|---|---|
| PubChem CID | 698991 |
| Molecular Formula | C20H22ClN3 |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 3-(4-tert-butylphenyl)-1-[(4-chlorophenyl)methyl]pyrazol-5-amine |
| SMILES | CC(C)(C)c1ccc(-c2cc(N)n(Cc3ccc(Cl)cc3)n2)cc1 |
| InChI | InChI=1S/C20H22ClN3/c1-20(2,3)16-8-6-15(7-9-16)18-12-19(22)24(23-18)13-14-4-10-17(21)11-5-14/h4-12H,13,22H2,1-3H3 |
| InChIKey | KKFLNODLOGLKMZ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |