C31H43FN8 — CID 136651497
8-[(E)-2-(5-fluorocyclohexa-1,3-dien-1-yl)ethenyl]-4-[4-(1-iminohexan-3-yl)piperazin-1-yl]-7-methyl-N-[5-[(E)-prop-1-enyl]-1H-pyrazol-3-yl]-5,6-dihydro-1H-1,3-diazocin-2-imine (PubChem CID 136651497) has the molecular formula C31H43FN8 and a molecular weight of 546.74 g/mol. Its IUPAC name is 8-[(E)-2-(5-fluorocyclohexa-1,3-dien-1-yl)ethenyl]-4-[4-(1-iminohexan-3-yl)piperazin-1-yl]-7-methyl-N-[5-[(E)-prop-1-enyl]-1H-pyrazol-3-yl]-5,6-dihydro-1H-1,3-diazocin-2-imine.
| Compound Name | 8-[(E)-2-(5-fluorocyclohexa-1,3-dien-1-yl)ethenyl]-4-[4-(1-iminohexan-3-yl)piperazin-1-yl]-7-methyl-N-[5-[(E)-prop-1-enyl]-1H-pyrazol-3-yl]-5,6-dihydro-1H-1,3-diazocin-2-imine |
|---|---|
| PubChem CID | 136651497 |
| Molecular Formula | C31H43FN8 |
| Molecular Weight | 546.74 g/mol |
| Exact Mass | 546.36 |
| IUPAC Name | 8-[(E)-2-(5-fluorocyclohexa-1,3-dien-1-yl)ethenyl]-4-[4-(1-iminohexan-3-yl)piperazin-1-yl]-7-methyl-N-[5-[(E)-prop-1-enyl]-1H-pyrazol-3-yl]-5,6-dihydro-1H-1,3-diazocin-2-imine |
| SMILES | [H]/N=C/CC(CCC)N1CCN(C2=N/C(=N\c3cc(/C=C/C)[nH]n3)NC(/C=C/C3=CC=CC(F)C3)=C(C)CC2)CC1 |
| InChI | InChI=1S/C31H43FN8/c1-4-7-26-22-29(38-37-26)35-31-34-28(13-12-24-9-6-10-25(32)21-24)23(3)11-14-30(36-31)40-19-17-39(18-20-40)27(8-5-2)15-16-33/h4,6-7,9-10,12-13,16,22,25,27,33H,5,8,11,14-15,17-21H2,1-3H3,(H2,34,35,37,38)/b7-4+,13-12+,28-23?,33-16+,36-30? |
| InChIKey | GYVLUYXKQAPMAD-QHKMMMRBSA-N |
| XLogP | 6.09 |
| TPSA | 95.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.74 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|