C30H32Cl2FN7OS — CID 136651752
N'-diazenyl-5-[[5-[2-(3,4-dichlorophenyl)propan-2-yl]-1-(4-fluorophenyl)imidazol-2-yl]sulfanylmethyl]-2-[2-(ethylamino)ethoxy]benzenecarboximidamide (PubChem CID 136651752) has the molecular formula C30H32Cl2FN7OS and a molecular weight of 628.61 g/mol. Its IUPAC name is N'-diazenyl-5-[[5-[2-(3,4-dichlorophenyl)propan-2-yl]-1-(4-fluorophenyl)imidazol-2-yl]sulfanylmethyl]-2-[2-(ethylamino)ethoxy]benzenecarboximidamide.
| Compound Name | N'-diazenyl-5-[[5-[2-(3,4-dichlorophenyl)propan-2-yl]-1-(4-fluorophenyl)imidazol-2-yl]sulfanylmethyl]-2-[2-(ethylamino)ethoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 136651752 |
| Molecular Formula | C30H32Cl2FN7OS |
| Molecular Weight | 628.61 g/mol |
| Exact Mass | 627.18 |
| IUPAC Name | N'-diazenyl-5-[[5-[2-(3,4-dichlorophenyl)propan-2-yl]-1-(4-fluorophenyl)imidazol-2-yl]sulfanylmethyl]-2-[2-(ethylamino)ethoxy]benzenecarboximidamide |
| SMILES | [H]/N=N/N=C(N)c1cc(CSc2ncc(C(C)(C)c3ccc(Cl)c(Cl)c3)n2-c2ccc(F)cc2)ccc1OCCNCC |
| InChI | InChI=1S/C30H32Cl2FN7OS/c1-4-36-13-14-41-26-12-5-19(15-23(26)28(34)38-39-35)18-42-29-37-17-27(40(29)22-9-7-21(33)8-10-22)30(2,3)20-6-11-24(31)25(32)16-20/h5-12,15-17,36H,4,13-14,18H2,1-3H3,(H3,34,35,38) |
| InChIKey | QXSSWZFKLQQJRB-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 113.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.61 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|