C26H20Cl2F3N3O2S — CID 87131643
4-[[5-[2-(3,4-dichlorophenyl)propan-2-yl]-1-(4-fluorophenyl)imidazol-2-yl]sulfanylmethyl]-3,5-difluoro-N-hydroxybenzamide (PubChem CID 87131643) has the molecular formula C26H20Cl2F3N3O2S and a molecular weight of 566.43 g/mol. Its IUPAC name is 4-[[5-[2-(3,4-dichlorophenyl)propan-2-yl]-1-(4-fluorophenyl)imidazol-2-yl]sulfanylmethyl]-3,5-difluoro-N-hydroxybenzamide.
| Compound Name | 4-[[5-[2-(3,4-dichlorophenyl)propan-2-yl]-1-(4-fluorophenyl)imidazol-2-yl]sulfanylmethyl]-3,5-difluoro-N-hydroxybenzamide |
|---|---|
| PubChem CID | 87131643 |
| Molecular Formula | C26H20Cl2F3N3O2S |
| Molecular Weight | 566.43 g/mol |
| Exact Mass | 565.06 |
| IUPAC Name | 4-[[5-[2-(3,4-dichlorophenyl)propan-2-yl]-1-(4-fluorophenyl)imidazol-2-yl]sulfanylmethyl]-3,5-difluoro-N-hydroxybenzamide |
| SMILES | CC(C)(c1ccc(Cl)c(Cl)c1)c1cnc(SCc2c(F)cc(C(=O)NO)cc2F)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C26H20Cl2F3N3O2S/c1-26(2,15-3-8-19(27)20(28)11-15)23-12-32-25(34(23)17-6-4-16(29)5-7-17)37-13-18-21(30)9-14(10-22(18)31)24(35)33-36/h3-12,36H,13H2,1-2H3,(H,33,35) |
| InChIKey | HQDKJYHIAQPBLV-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.43 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|