C27H22Cl2F3N3O3S — CID 87131691
4-[[5-[2-(3,4-dichlorophenyl)propan-2-yl]-1-(4-fluoro-3-methoxyphenyl)imidazol-2-yl]sulfanylmethyl]-3,5-difluoro-N-hydroxybenzamide (PubChem CID 87131691) has the molecular formula C27H22Cl2F3N3O3S and a molecular weight of 596.46 g/mol. Its IUPAC name is 4-[[5-[2-(3,4-dichlorophenyl)propan-2-yl]-1-(4-fluoro-3-methoxyphenyl)imidazol-2-yl]sulfanylmethyl]-3,5-difluoro-N-hydroxybenzamide.
| Compound Name | 4-[[5-[2-(3,4-dichlorophenyl)propan-2-yl]-1-(4-fluoro-3-methoxyphenyl)imidazol-2-yl]sulfanylmethyl]-3,5-difluoro-N-hydroxybenzamide |
|---|---|
| PubChem CID | 87131691 |
| Molecular Formula | C27H22Cl2F3N3O3S |
| Molecular Weight | 596.46 g/mol |
| Exact Mass | 595.07 |
| IUPAC Name | 4-[[5-[2-(3,4-dichlorophenyl)propan-2-yl]-1-(4-fluoro-3-methoxyphenyl)imidazol-2-yl]sulfanylmethyl]-3,5-difluoro-N-hydroxybenzamide |
| SMILES | COc1cc(-n2c(C(C)(C)c3ccc(Cl)c(Cl)c3)cnc2SCc2c(F)cc(C(=O)NO)cc2F)ccc1F |
| InChI | InChI=1S/C27H22Cl2F3N3O3S/c1-27(2,15-4-6-18(28)19(29)10-15)24-12-33-26(35(24)16-5-7-20(30)23(11-16)38-3)39-13-17-21(31)8-14(9-22(17)32)25(36)34-37/h4-12,37H,13H2,1-3H3,(H,34,36) |
| InChIKey | XVFRXYVMYCYHKD-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.46 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|