C24H20ClFN6O5 — CID 136653120
4-(10'-chloro-9'-hydroxy-2',4'-dimethyl-2,4,6-trioxospiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a][1,5]naphthyridine]-8'-carboximidoyl)-2-fluorobenzonitrile (PubChem CID 136653120) has the molecular formula C24H20ClFN6O5 and a molecular weight of 526.91 g/mol. Its IUPAC name is 4-(10'-chloro-9'-hydroxy-2',4'-dimethyl-2,4,6-trioxospiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a][1,5]naphthyridine]-8'-carboximidoyl)-2-fluorobenzonitrile.
| Compound Name | 4-(10'-chloro-9'-hydroxy-2',4'-dimethyl-2,4,6-trioxospiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a][1,5]naphthyridine]-8'-carboximidoyl)-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 136653120 |
| Molecular Formula | C24H20ClFN6O5 |
| Molecular Weight | 526.91 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | 4-(10'-chloro-9'-hydroxy-2',4'-dimethyl-2,4,6-trioxospiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a][1,5]naphthyridine]-8'-carboximidoyl)-2-fluorobenzonitrile |
| SMILES | [H]/N=C(\c1ccc(C#N)c(F)c1)c1nc2c(c(Cl)c1O)N1CC(C)OC(C)C1C1(C2)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C24H20ClFN6O5/c1-9-8-32-18-14(6-24(20(32)10(2)37-9)21(34)30-23(36)31-22(24)35)29-17(19(33)15(18)25)16(28)11-3-4-12(7-27)13(26)5-11/h3-5,9-10,20,28,33H,6,8H2,1-2H3,(H2,30,31,34,35,36)/b28-16+ |
| InChIKey | KYNAHOJYZCRILF-LQKURTRISA-N |
| XLogP | 1.76 |
| TPSA | 168.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.91 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|