C22H22ClN7O2 — CID 136655043
N'-amino-2-[4-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]-2-oxo-1H-pyridin-3-yl]-7-methyl-3H-benzimidazole-5-carboximidamide (PubChem CID 136655043) has the molecular formula C22H22ClN7O2 and a molecular weight of 451.92 g/mol. Its IUPAC name is N'-amino-2-[4-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]-2-oxo-1H-pyridin-3-yl]-7-methyl-3H-benzimidazole-5-carboximidamide.
| Compound Name | N'-amino-2-[4-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]-2-oxo-1H-pyridin-3-yl]-7-methyl-3H-benzimidazole-5-carboximidamide |
|---|---|
| PubChem CID | 136655043 |
| Molecular Formula | C22H22ClN7O2 |
| Molecular Weight | 451.92 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | N'-amino-2-[4-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]-2-oxo-1H-pyridin-3-yl]-7-methyl-3H-benzimidazole-5-carboximidamide |
| SMILES | Cc1cc(C(N)=NN)cc2[nH]c(-c3c(NCC(O)c4cccc(Cl)c4)cc[nH]c3=O)nc12 |
| InChI | InChI=1S/C22H22ClN7O2/c1-11-7-13(20(24)30-25)9-16-19(11)29-21(28-16)18-15(5-6-26-22(18)32)27-10-17(31)12-3-2-4-14(23)8-12/h2-9,17,31H,10,25H2,1H3,(H2,24,30)(H,28,29)(H2,26,27,32) |
| InChIKey | IRQQRUYAWGPKAO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 158.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.92 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|