C21H21N3O — CID 136655135
9-amino-5-(3,5-dimethylphenyl)-2-ethylpyrrolo[3,4-b]quinolin-1-ol (PubChem CID 136655135) has the molecular formula C21H21N3O and a molecular weight of 331.42 g/mol. Its IUPAC name is 9-amino-5-(3,5-dimethylphenyl)-2-ethylpyrrolo[3,4-b]quinolin-1-ol.
| Compound Name | 9-amino-5-(3,5-dimethylphenyl)-2-ethylpyrrolo[3,4-b]quinolin-1-ol |
|---|---|
| PubChem CID | 136655135 |
| Molecular Formula | C21H21N3O |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 9-amino-5-(3,5-dimethylphenyl)-2-ethylpyrrolo[3,4-b]quinolin-1-ol |
| SMILES | CCn1cc2nc3c(-c4cc(C)cc(C)c4)cccc3c(N)c2c1O |
| InChI | InChI=1S/C21H21N3O/c1-4-24-11-17-18(21(24)25)19(22)16-7-5-6-15(20(16)23-17)14-9-12(2)8-13(3)10-14/h5-11,25H,4,22H2,1-3H3 |
| InChIKey | QDRHIFULUQLUDK-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |