C19H16Cl2N4O — CID 136655240
9-amino-5-(2,6-dichloro-3-pyridinyl)-2-propylpyrrolo[3,4-b]quinolin-1-ol (PubChem CID 136655240) has the molecular formula C19H16Cl2N4O and a molecular weight of 387.27 g/mol. Its IUPAC name is 9-amino-5-(2,6-dichloro-3-pyridinyl)-2-propylpyrrolo[3,4-b]quinolin-1-ol.
| Compound Name | 9-amino-5-(2,6-dichloro-3-pyridinyl)-2-propylpyrrolo[3,4-b]quinolin-1-ol |
|---|---|
| PubChem CID | 136655240 |
| Molecular Formula | C19H16Cl2N4O |
| Molecular Weight | 387.27 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | 9-amino-5-(2,6-dichloro-3-pyridinyl)-2-propylpyrrolo[3,4-b]quinolin-1-ol |
| SMILES | CCCn1cc2nc3c(-c4ccc(Cl)nc4Cl)cccc3c(N)c2c1O |
| InChI | InChI=1S/C19H16Cl2N4O/c1-2-8-25-9-13-15(19(25)26)16(22)12-5-3-4-10(17(12)23-13)11-6-7-14(20)24-18(11)21/h3-7,9,26H,2,8,22H2,1H3 |
| InChIKey | UUVDHSSWQBJLGE-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.27 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|