C18H21N3O — CID 135977782
9-amino-5-butyl-2-prop-2-enylpyrrolo[3,4-b]quinolin-1-ol (PubChem CID 135977782) has the molecular formula C18H21N3O and a molecular weight of 295.39 g/mol. Its IUPAC name is 9-amino-5-butyl-2-prop-2-enylpyrrolo[3,4-b]quinolin-1-ol.
| Compound Name | 9-amino-5-butyl-2-prop-2-enylpyrrolo[3,4-b]quinolin-1-ol |
|---|---|
| PubChem CID | 135977782 |
| Molecular Formula | C18H21N3O |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | 9-amino-5-butyl-2-prop-2-enylpyrrolo[3,4-b]quinolin-1-ol |
| SMILES | C=CCn1cc2nc3c(CCCC)cccc3c(N)c2c1O |
| InChI | InChI=1S/C18H21N3O/c1-3-5-7-12-8-6-9-13-16(19)15-14(20-17(12)13)11-21(10-4-2)18(15)22/h4,6,8-9,11,22H,2-3,5,7,10,19H2,1H3 |
| InChIKey | MBSDKXMWDIGEEA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|