About 3-butyl-2-ethenylphenol
3-butyl-2-ethenylphenol (PubChem CID 23312031) has the molecular formula C12H16O
and a molecular weight of 176.26 g/mol. Its IUPAC name is 3-butyl-2-ethenylphenol.
Molecular Properties
| Compound Name | 3-butyl-2-ethenylphenol |
| PubChem CID | 23312031 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 3-butyl-2-ethenylphenol |
| SMILES | C=Cc1c(O)cccc1CCCC |
| InChI | InChI=1S/C12H16O/c1-3-5-7-10-8-6-9-12(13)11(10)4-2/h4,6,8-9,13H,2-3,5,7H2,1H3 |
| InChIKey | HKULHMRYPBLBRI-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-butyl-2-ethenylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-2-ethenylphenol?
The IUPAC name of 3-butyl-2-ethenylphenol (CID 23312031) is 3-butyl-2-ethenylphenol.
What is the SMILES notation for 3-butyl-2-ethenylphenol?
The canonical SMILES for 3-butyl-2-ethenylphenol is C=Cc1c(O)cccc1CCCC.
What is the InChIKey of 3-butyl-2-ethenylphenol?
The InChIKey is HKULHMRYPBLBRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O/c1-3-5-7-10-8-6-9-12(13)11(10)4-2/h4,6,8-9,13H,2-3,5,7H2,1H3.
What are the key properties of 3-butyl-2-ethenylphenol?
3-butyl-2-ethenylphenol has a molecular weight of 176.26 g/mol, XLogP of 3.38, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-2-ethenylphenol is sourced from PubChem (CID 23312031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).