C17H15N4O3S2+ — CID 136657503
5-[(6-hydroxy-4-oxo-1-prop-2-enyl-2-sulfanylidenepyrimidin-5-yl)methylidene]-4-(4-methylpyridin-1-ium-1-yl)-1,3-thiazol-2-one (PubChem CID 136657503) has the molecular formula C17H15N4O3S2+ and a molecular weight of 387.47 g/mol. Its IUPAC name is 5-[(6-hydroxy-4-oxo-1-prop-2-enyl-2-sulfanylidenepyrimidin-5-yl)methylidene]-4-(4-methylpyridin-1-ium-1-yl)-1,3-thiazol-2-one.
| Compound Name | 5-[(6-hydroxy-4-oxo-1-prop-2-enyl-2-sulfanylidenepyrimidin-5-yl)methylidene]-4-(4-methylpyridin-1-ium-1-yl)-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 136657503 |
| Molecular Formula | C17H15N4O3S2+ |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | 5-[(6-hydroxy-4-oxo-1-prop-2-enyl-2-sulfanylidenepyrimidin-5-yl)methylidene]-4-(4-methylpyridin-1-ium-1-yl)-1,3-thiazol-2-one |
| SMILES | C=CCn1c(O)c(C=C2SC(=O)N=C2[n+]2ccc(C)cc2)c(=O)[nH]c1=S |
| InChI | InChI=1S/C17H14N4O3S2/c1-3-6-21-15(23)11(14(22)19-16(21)25)9-12-13(18-17(24)26-12)20-7-4-10(2)5-8-20/h3-5,7-9H,1,6H2,2H3,(H-,18,19,22,23,24,25)/p+1 |
| InChIKey | GPQTYSBQHORBGX-UHFFFAOYSA-O |
| XLogP | 2.55 |
| TPSA | 91.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|