C24H31N3O2S — CID 91362561
5-[3-[4-(dibutylamino)phenyl]propa-1,2-dienyl]-6-hydroxy-1-prop-2-enyl-2-sulfanylidenepyrimidin-4-one (PubChem CID 91362561) has the molecular formula C24H31N3O2S and a molecular weight of 425.60 g/mol. Its IUPAC name is 5-[3-[4-(dibutylamino)phenyl]propa-1,2-dienyl]-6-hydroxy-1-prop-2-enyl-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 5-[3-[4-(dibutylamino)phenyl]propa-1,2-dienyl]-6-hydroxy-1-prop-2-enyl-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 91362561 |
| Molecular Formula | C24H31N3O2S |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 5-[3-[4-(dibutylamino)phenyl]propa-1,2-dienyl]-6-hydroxy-1-prop-2-enyl-2-sulfanylidenepyrimidin-4-one |
| SMILES | C=CCn1c(O)c(C=C=Cc2ccc(N(CCCC)CCCC)cc2)c(=O)[nH]c1=S |
| InChI | InChI=1S/C24H31N3O2S/c1-4-7-17-26(18-8-5-2)20-14-12-19(13-15-20)10-9-11-21-22(28)25-24(30)27(16-6-3)23(21)29/h6,10-15,29H,3-5,7-8,16-18H2,1-2H3,(H,25,28,30) |
| InChIKey | CZCFRMONODFJKF-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 61.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|