C41H58N2O4 — CID 136658377
[3-tert-butyl-5-[[(1R,2R)-2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]-4-hydroxyphenyl] cyclooct-4-ene-1-carboxylate (PubChem CID 136658377) has the molecular formula C41H58N2O4 and a molecular weight of 642.93 g/mol. Its IUPAC name is [3-tert-butyl-5-[[(1R,2R)-2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]-4-hydroxyphenyl] cyclooct-4-ene-1-carboxylate.
| Compound Name | [3-tert-butyl-5-[[(1R,2R)-2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]-4-hydroxyphenyl] cyclooct-4-ene-1-carboxylate |
|---|---|
| PubChem CID | 136658377 |
| Molecular Formula | C41H58N2O4 |
| Molecular Weight | 642.93 g/mol |
| Exact Mass | 642.44 |
| IUPAC Name | [3-tert-butyl-5-[[(1R,2R)-2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]-4-hydroxyphenyl] cyclooct-4-ene-1-carboxylate |
| SMILES | CC(C)(C)c1cc(/C=N/[C@@H]2CCCC[C@H]2/N=C/c2cc(OC(=O)C3CCC=CCCC3)cc(C(C)(C)C)c2O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C41H58N2O4/c1-39(2,3)30-21-28(36(44)32(23-30)40(4,5)6)25-42-34-19-15-16-20-35(34)43-26-29-22-31(24-33(37(29)45)41(7,8)9)47-38(46)27-17-13-11-10-12-14-18-27/h10-11,21-27,34-35,44-45H,12-20H2,1-9H3/b11-10?,42-25+,43-26+/t27?,34-,35-/m1/s1 |
| InChIKey | IIUCQKVAJCGXQU-GGQJJXENSA-N |
| XLogP | 9.88 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.93 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|