C39H62N2O6Si — CID 159932209
[3-tert-butyl-5-[[(1R,2R)-2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]-4-hydroxyphenyl] 3-[dimethoxy(methyl)silyl]propanoate;methane (PubChem CID 159932209) has the molecular formula C39H62N2O6Si and a molecular weight of 683.02 g/mol. Its IUPAC name is [3-tert-butyl-5-[[(1R,2R)-2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]-4-hydroxyphenyl] 3-[dimethoxy(methyl)silyl]propanoate;methane.
| Compound Name | [3-tert-butyl-5-[[(1R,2R)-2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]-4-hydroxyphenyl] 3-[dimethoxy(methyl)silyl]propanoate;methane |
|---|---|
| PubChem CID | 159932209 |
| Molecular Formula | C39H62N2O6Si |
| Molecular Weight | 683.02 g/mol |
| Exact Mass | 682.44 |
| IUPAC Name | [3-tert-butyl-5-[[(1R,2R)-2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]-4-hydroxyphenyl] 3-[dimethoxy(methyl)silyl]propanoate;methane |
| SMILES | C.CO[Si](C)(CCC(=O)Oc1cc(/C=N\[C@@H]2CCCC[C@H]2/N=C/c2cc(C(C)(C)C)cc(C(C)(C)C)c2O)c(O)c(C(C)(C)C)c1)OC |
| InChI | InChI=1S/C38H58N2O6Si.CH4/c1-36(2,3)27-19-25(34(42)29(21-27)37(4,5)6)23-39-31-15-13-14-16-32(31)40-24-26-20-28(22-30(35(26)43)38(7,8)9)46-33(41)17-18-47(12,44-10)45-11;/h19-24,31-32,42-43H,13-18H2,1-12H3;1H4/b39-23+,40-24-;/t31-,32-;/m1./s1 |
| InChIKey | NZUBJZYRFNNKGL-QIJMXKAPSA-N |
| XLogP | 9.14 |
| TPSA | 109.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.02 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|