C23H25FN4O3 — CID 136658391
tert-butyl-[1-[6-fluoro-2-(2-hydroxyphenyl)quinazolin-4-yl]pyrrolidin-3-yl]carbamic acid (PubChem CID 136658391) has the molecular formula C23H25FN4O3 and a molecular weight of 424.48 g/mol. Its IUPAC name is tert-butyl-[1-[6-fluoro-2-(2-hydroxyphenyl)quinazolin-4-yl]pyrrolidin-3-yl]carbamic acid.
| Compound Name | tert-butyl-[1-[6-fluoro-2-(2-hydroxyphenyl)quinazolin-4-yl]pyrrolidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 136658391 |
| Molecular Formula | C23H25FN4O3 |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | tert-butyl-[1-[6-fluoro-2-(2-hydroxyphenyl)quinazolin-4-yl]pyrrolidin-3-yl]carbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)C1CCN(c2nc(-c3ccccc3O)nc3ccc(F)cc23)C1 |
| InChI | InChI=1S/C23H25FN4O3/c1-23(2,3)28(22(30)31)15-10-11-27(13-15)21-17-12-14(24)8-9-18(17)25-20(26-21)16-6-4-5-7-19(16)29/h4-9,12,15,29H,10-11,13H2,1-3H3,(H,30,31) |
| InChIKey | LDHRXVIGSGIFFP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |