C23H27FN4O3 — CID 143465403
2-(6-fluoro-4-pyrrolidin-1-ylquinazolin-2-yl)phenol;2-methylpropyl carbamate (PubChem CID 143465403) has the molecular formula C23H27FN4O3 and a molecular weight of 426.49 g/mol. Its IUPAC name is 2-(6-fluoro-4-pyrrolidin-1-ylquinazolin-2-yl)phenol;2-methylpropyl carbamate.
| Compound Name | 2-(6-fluoro-4-pyrrolidin-1-ylquinazolin-2-yl)phenol;2-methylpropyl carbamate |
|---|---|
| PubChem CID | 143465403 |
| Molecular Formula | C23H27FN4O3 |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 2-(6-fluoro-4-pyrrolidin-1-ylquinazolin-2-yl)phenol;2-methylpropyl carbamate |
| SMILES | CC(C)COC(N)=O.Oc1ccccc1-c1nc(N2CCCC2)c2cc(F)ccc2n1 |
| InChI | InChI=1S/C18H16FN3O.C5H11NO2/c19-12-7-8-15-14(11-12)18(22-9-3-4-10-22)21-17(20-15)13-5-1-2-6-16(13)23;1-4(2)3-8-5(6)7/h1-2,5-8,11,23H,3-4,9-10H2;4H,3H2,1-2H3,(H2,6,7) |
| InChIKey | IPNHMTAWLFBDQG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |