C28H29N7O4 — CID 136659352
3-[2-[4-[[4-[2-(methoxyamino)prop-1-enyl]-2-methyl-5-oxo-7-propyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]methyl]phenyl]phenyl]-4H-1,2,4-oxadiazol-5-one (PubChem CID 136659352) has the molecular formula C28H29N7O4 and a molecular weight of 527.59 g/mol. Its IUPAC name is 3-[2-[4-[[4-[2-(methoxyamino)prop-1-enyl]-2-methyl-5-oxo-7-propyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]methyl]phenyl]phenyl]-4H-1,2,4-oxadiazol-5-one.
| Compound Name | 3-[2-[4-[[4-[2-(methoxyamino)prop-1-enyl]-2-methyl-5-oxo-7-propyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]methyl]phenyl]phenyl]-4H-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 136659352 |
| Molecular Formula | C28H29N7O4 |
| Molecular Weight | 527.59 g/mol |
| Exact Mass | 527.23 |
| IUPAC Name | 3-[2-[4-[[4-[2-(methoxyamino)prop-1-enyl]-2-methyl-5-oxo-7-propyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]methyl]phenyl]phenyl]-4H-1,2,4-oxadiazol-5-one |
| SMILES | CCCc1c(Cc2ccc(-c3ccccc3-c3noc(=O)[nH]3)cc2)c(=O)n(C=C(C)NOC)c2nc(C)nn12 |
| InChI | InChI=1S/C28H29N7O4/c1-5-8-24-23(26(36)34(16-17(2)32-38-4)27-29-18(3)31-35(24)27)15-19-11-13-20(14-12-19)21-9-6-7-10-22(21)25-30-28(37)39-33-25/h6-7,9-14,16,32H,5,8,15H2,1-4H3,(H,30,33,37) |
| InChIKey | WPMJKZCQVVLPSN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 132.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.59 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|