C16H23N5O2 — CID 136662139
2-(2-ethyl-4-methyl-6-oxo-1H-pyrimidin-5-yl)-N-(4-pyrazol-1-ylbutan-2-yl)acetamide (PubChem CID 136662139) has the molecular formula C16H23N5O2 and a molecular weight of 317.39 g/mol. Its IUPAC name is 2-(2-ethyl-4-methyl-6-oxo-1H-pyrimidin-5-yl)-N-(4-pyrazol-1-ylbutan-2-yl)acetamide.
| Compound Name | 2-(2-ethyl-4-methyl-6-oxo-1H-pyrimidin-5-yl)-N-(4-pyrazol-1-ylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 136662139 |
| Molecular Formula | C16H23N5O2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | 2-(2-ethyl-4-methyl-6-oxo-1H-pyrimidin-5-yl)-N-(4-pyrazol-1-ylbutan-2-yl)acetamide |
| SMILES | CCc1nc(C)c(CC(=O)NC(C)CCn2cccn2)c(=O)[nH]1 |
| InChI | InChI=1S/C16H23N5O2/c1-4-14-19-12(3)13(16(23)20-14)10-15(22)18-11(2)6-9-21-8-5-7-17-21/h5,7-8,11H,4,6,9-10H2,1-3H3,(H,18,22)(H,19,20,23) |
| InChIKey | KKWXLFBFNOUNCO-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |