C15H18N6O2 — CID 136662158
2-amino-4-[4-(2-pyridin-3-ylacetyl)piperazin-1-yl]-1H-pyrimidin-6-one (PubChem CID 136662158) has the molecular formula C15H18N6O2 and a molecular weight of 314.35 g/mol. Its IUPAC name is 2-amino-4-[4-(2-pyridin-3-ylacetyl)piperazin-1-yl]-1H-pyrimidin-6-one.
| Compound Name | 2-amino-4-[4-(2-pyridin-3-ylacetyl)piperazin-1-yl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136662158 |
| Molecular Formula | C15H18N6O2 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 2-amino-4-[4-(2-pyridin-3-ylacetyl)piperazin-1-yl]-1H-pyrimidin-6-one |
| SMILES | Nc1nc(N2CCN(C(=O)Cc3cccnc3)CC2)cc(=O)[nH]1 |
| InChI | InChI=1S/C15H18N6O2/c16-15-18-12(9-13(22)19-15)20-4-6-21(7-5-20)14(23)8-11-2-1-3-17-10-11/h1-3,9-10H,4-8H2,(H3,16,18,19,22) |
| InChIKey | JNQONZFBGURVDC-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |