C16H22N6O2 — CID 136998462
2-amino-4-[4-[3-(1-methylpyrrol-2-yl)propanoyl]piperazin-1-yl]-1H-pyrimidin-6-one (PubChem CID 136998462) has the molecular formula C16H22N6O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is 2-amino-4-[4-[3-(1-methylpyrrol-2-yl)propanoyl]piperazin-1-yl]-1H-pyrimidin-6-one.
| Compound Name | 2-amino-4-[4-[3-(1-methylpyrrol-2-yl)propanoyl]piperazin-1-yl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136998462 |
| Molecular Formula | C16H22N6O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 2-amino-4-[4-[3-(1-methylpyrrol-2-yl)propanoyl]piperazin-1-yl]-1H-pyrimidin-6-one |
| SMILES | Cn1cccc1CCC(=O)N1CCN(c2cc(=O)[nH]c(N)n2)CC1 |
| InChI | InChI=1S/C16H22N6O2/c1-20-6-2-3-12(20)4-5-15(24)22-9-7-21(8-10-22)13-11-14(23)19-16(17)18-13/h2-3,6,11H,4-5,7-10H2,1H3,(H3,17,18,19,23) |
| InChIKey | PLTBSAJTTBLQJL-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 100.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |