C18H21N5O2 — CID 136663278
2-(2,5-dimethyl-6-oxo-1H-pyrimidin-4-yl)-N-(3-indazol-1-ylpropyl)acetamide (PubChem CID 136663278) has the molecular formula C18H21N5O2 and a molecular weight of 339.40 g/mol. Its IUPAC name is 2-(2,5-dimethyl-6-oxo-1H-pyrimidin-4-yl)-N-(3-indazol-1-ylpropyl)acetamide.
| Compound Name | 2-(2,5-dimethyl-6-oxo-1H-pyrimidin-4-yl)-N-(3-indazol-1-ylpropyl)acetamide |
|---|---|
| PubChem CID | 136663278 |
| Molecular Formula | C18H21N5O2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 2-(2,5-dimethyl-6-oxo-1H-pyrimidin-4-yl)-N-(3-indazol-1-ylpropyl)acetamide |
| SMILES | Cc1nc(CC(=O)NCCCn2ncc3ccccc32)c(C)c(=O)[nH]1 |
| InChI | InChI=1S/C18H21N5O2/c1-12-15(21-13(2)22-18(12)25)10-17(24)19-8-5-9-23-16-7-4-3-6-14(16)11-20-23/h3-4,6-7,11H,5,8-10H2,1-2H3,(H,19,24)(H,21,22,25) |
| InChIKey | ZOHRWVSITUWYBS-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|