C14H20N4O3S — CID 91837892
N-(3-indazol-1-ylpropyl)-2-(methanesulfonamido)propanamide (PubChem CID 91837892) has the molecular formula C14H20N4O3S and a molecular weight of 324.41 g/mol. Its IUPAC name is N-(3-indazol-1-ylpropyl)-2-(methanesulfonamido)propanamide.
| Compound Name | N-(3-indazol-1-ylpropyl)-2-(methanesulfonamido)propanamide |
|---|---|
| PubChem CID | 91837892 |
| Molecular Formula | C14H20N4O3S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | N-(3-indazol-1-ylpropyl)-2-(methanesulfonamido)propanamide |
| SMILES | CC(NS(C)(=O)=O)C(=O)NCCCn1ncc2ccccc21 |
| InChI | InChI=1S/C14H20N4O3S/c1-11(17-22(2,20)21)14(19)15-8-5-9-18-13-7-4-3-6-12(13)10-16-18/h3-4,6-7,10-11,17H,5,8-9H2,1-2H3,(H,15,19) |
| InChIKey | GZXBPZLJKBMOSM-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|