C22H18Cl2N2O4 — CID 136663459
2,2-bis(4-chlorophenyl)-2-hydroxy-N-[(Z)-(2-hydroxy-3-methoxyphenyl)methylideneamino]acetamide (PubChem CID 136663459) has the molecular formula C22H18Cl2N2O4 and a molecular weight of 445.30 g/mol. Its IUPAC name is 2,2-bis(4-chlorophenyl)-2-hydroxy-N-[(Z)-(2-hydroxy-3-methoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2,2-bis(4-chlorophenyl)-2-hydroxy-N-[(Z)-(2-hydroxy-3-methoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 136663459 |
| Molecular Formula | C22H18Cl2N2O4 |
| Molecular Weight | 445.30 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | 2,2-bis(4-chlorophenyl)-2-hydroxy-N-[(Z)-(2-hydroxy-3-methoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1cccc(/C=N\NC(=O)C(O)(c2ccc(Cl)cc2)c2ccc(Cl)cc2)c1O |
| InChI | InChI=1S/C22H18Cl2N2O4/c1-30-19-4-2-3-14(20(19)27)13-25-26-21(28)22(29,15-5-9-17(23)10-6-15)16-7-11-18(24)12-8-16/h2-13,27,29H,1H3,(H,26,28)/b25-13- |
| InChIKey | ZJHJDZYZZIXJMB-MXAYSNPKSA-N |
| XLogP | 4.09 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.30 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|