C17H22N4O2S — CID 136663685
N-[(4-oxo-3H-quinazolin-2-yl)methyl]-2-(2-pyrrolidin-1-ylethylsulfanyl)acetamide (PubChem CID 136663685) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is N-[(4-oxo-3H-quinazolin-2-yl)methyl]-2-(2-pyrrolidin-1-ylethylsulfanyl)acetamide.
| Compound Name | N-[(4-oxo-3H-quinazolin-2-yl)methyl]-2-(2-pyrrolidin-1-ylethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 136663685 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | N-[(4-oxo-3H-quinazolin-2-yl)methyl]-2-(2-pyrrolidin-1-ylethylsulfanyl)acetamide |
| SMILES | O=C(CSCCN1CCCC1)NCc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C17H22N4O2S/c22-16(12-24-10-9-21-7-3-4-8-21)18-11-15-19-14-6-2-1-5-13(14)17(23)20-15/h1-2,5-6H,3-4,7-12H2,(H,18,22)(H,19,20,23) |
| InChIKey | YCRYGBBRCZJWFC-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|