C18H21N3O4S — CID 137168931
2-methyl-1-[3-[(4-oxo-3H-quinazolin-2-yl)methylsulfanyl]propanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 137168931) has the molecular formula C18H21N3O4S and a molecular weight of 375.45 g/mol. Its IUPAC name is 2-methyl-1-[3-[(4-oxo-3H-quinazolin-2-yl)methylsulfanyl]propanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 2-methyl-1-[3-[(4-oxo-3H-quinazolin-2-yl)methylsulfanyl]propanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 137168931 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 2-methyl-1-[3-[(4-oxo-3H-quinazolin-2-yl)methylsulfanyl]propanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC1(C(=O)O)CCCN1C(=O)CCSCc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C18H21N3O4S/c1-18(17(24)25)8-4-9-21(18)15(22)7-10-26-11-14-19-13-6-3-2-5-12(13)16(23)20-14/h2-3,5-6H,4,7-11H2,1H3,(H,24,25)(H,19,20,23) |
| InChIKey | NIOPBPKFDSORGR-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 103.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|