C18H25ClN4O2S — CID 137119940
2-[[3-[3-(methylaminomethyl)pyrrolidin-1-yl]-3-oxopropyl]sulfanylmethyl]-3H-quinazolin-4-one;hydrochloride (PubChem CID 137119940) has the molecular formula C18H25ClN4O2S and a molecular weight of 396.94 g/mol. Its IUPAC name is 2-[[3-[3-(methylaminomethyl)pyrrolidin-1-yl]-3-oxopropyl]sulfanylmethyl]-3H-quinazolin-4-one;hydrochloride.
| Compound Name | 2-[[3-[3-(methylaminomethyl)pyrrolidin-1-yl]-3-oxopropyl]sulfanylmethyl]-3H-quinazolin-4-one;hydrochloride |
|---|---|
| PubChem CID | 137119940 |
| Molecular Formula | C18H25ClN4O2S |
| Molecular Weight | 396.94 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 2-[[3-[3-(methylaminomethyl)pyrrolidin-1-yl]-3-oxopropyl]sulfanylmethyl]-3H-quinazolin-4-one;hydrochloride |
| SMILES | CNCC1CCN(C(=O)CCSCc2nc3ccccc3c(=O)[nH]2)C1.Cl |
| InChI | InChI=1S/C18H24N4O2S.ClH/c1-19-10-13-6-8-22(11-13)17(23)7-9-25-12-16-20-15-5-3-2-4-14(15)18(24)21-16;/h2-5,13,19H,6-12H2,1H3,(H,20,21,24);1H |
| InChIKey | GIQGBVFXFPPXKP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.94 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|